| Product Name | lauric acid, ester with hydroxypropanediyl diacetate |
| CAS No. | 30899-62-8 |
| Synonyms | Dodecanoic acid, ester with 1,2,3-propanetriol diacetate; Dodecanoic acid, ester with 1,2,3 propanetriol diacetate; Lauric acid, ester with hydroxypropanediyl diacetate; 2,3-bis(acetyloxy)propyl dodecanoate |
| InChI | InChI=1/C19H34O6/c1-4-5-6-7-8-9-10-11-12-13-19(22)24-15-18(25-17(3)21)14-23-16(2)20/h18H,4-15H2,1-3H3 |
| Molecular Formula | C19H34O6 |
| Molecular Weight | 358.4697 |
| Density | 1.015g/cm3 |
| Boiling point | 401.6°C at 760 mmHg |
| Flash point | 169°C |
| Refractive index | 1.452 |
30899-62-8 lauric acid, ester with hydroxypropanediyl diacetate
service@apichina.com