| Product Name | Lanthionine |
| CAS No. | 922-55-4 |
| Synonyms | lanthionine, mixture of dl and meso; di(2-amino-2-carboxyethyl) sulphide; S-[(2R)-2-amino-2-carboxyethyl]-D-cysteine; S-[(2R)-2-amino-2-carboxyethyl]-L-cysteine; (2S,2'S)-3,3'-sulfanediylbis(2-ammoniopropanoate) |
| InChI | InChI=1/C6H12N2O4S/c7-3(5(9)10)1-13-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m1/s1 |
| Molecular Formula | C6H12N2O4S |
| Molecular Weight | 208.2355 |
| Density | 1.499g/cm3 |
| Melting point | 280-283℃ |
| Boiling point | 462.6°C at 760 mmHg |
| Flash point | 233.5°C |
| Refractive index | 1.606 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
922-55-4 lanthionine
service@apichina.com