| Product Name | L-Valine |
| CAS No. | 72-18-4;7004-03-7 |
| Synonyms | L-2-Amino-3-methylbutyric acid; L-Valine, FCC Grade L-2-Amino-3-methylbutyric acid, FCC Grade; H-Val-OH; 2-Amino-3-methylbutanoic acid; Lvaline; L-2-Aminoisovaleric acid; (S)-(+)-2-Amino-3-methylbutyric acid; ; 1-2-Amino-3-methylbutyric acid; Valine |
| InChI | InChI:1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.1478 |
| Melting point | 315℃ |
| Water solubility | 85 g/L (20℃) |
| Refractive index | 1.507 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
72-18-4;7004-03-7 l-valine
service@apichina.com