| Product Name | L-Thyroxine |
| CAS No. | 51-48-9;25416-65-3 |
| Synonyms | levothyroxine; 3-[4-(4-Hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]-alanine; 3,5,3',5'-tetraiodothyronine; beta-[(3,5-diiodo-4-hydroxyphenoxy)-3,5-diiodophenyl]alanine; l-3,5,3',5'-tetraiodothyronine; l-t4; o-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-l-tyrosin; o-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodotyrosine; t4(hormone); tetraiodothyronine; O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine |
| InChI | InChI=1/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m0/s1 |
| Molecular Formula | C15H11I4NO4 |
| Molecular Weight | 776.87 |
| Density | 2.635g/cm3 |
| Melting point | 223℃ (dec.) |
| Boiling point | 576.3°C at 760 mmHg |
| Flash point | 302.3°C |
| Water solubility | insoluble |
| Refractive index | 1.795 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S24/25:; |
51-48-9;25416-65-3 l-thyroxine
service@apichina.com