| Product Name | L-Lactide S |
| CAS No. | 4511-42-6 |
| Synonyms | (3S)-cis-3,6-Dimethyl-1,4-dioxane-2,5-dione; Lactide; L-Lactide; (3S)-Cis-3,6-dimethyl-1,4-dioxane-2,5-dione; (S,S)-3,6-Dimethyl-1,4-dioxane-2,5-dione; L-Lactide; 3,6-dimethyl-1,4-dioxane-2,5-dione; (3R,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione; L-(-)-Lactide |
| InChI | InChI=1/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3/t3-,4+ |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.1253 |
| Density | 1.186g/cm3 |
| Melting point | 92-98℃ |
| Boiling point | 285.5°C at 760 mmHg |
| Flash point | 150.6°C |
| Refractive index | 1.429 |
| Risk Codes | R36/37:Irritating to eyes and respiratory system.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4511-42-6 l-lactide s
service@apichina.com