| Product Name | L-glycero-L-ido-heptonic acid, cyclic 5,6-ester with boric acid, disodium salt |
| CAS No. | 68134-31-6 |
| Synonyms | L-glycero-L-ido-Heptonic acid, cyclic 5,6-ester with boric acid (H3BO3), sodium salt (1:2); L-Glycero-L-ido-heptonic acid, cyclic 5,6-ester with boric acid, disodium salt; L-glycero-L-ido-Heptonic acid, cyclic 5,6-ester with boric acid (H3BO3), disodium salt; disodium 3,4-dihydroxy-4-[2-hydroxy-5-(hydroxymethyl)-1,3,2-dioxaborolan-4-yl]-2-oxidobutanoate |
| InChI | InChI=1/C7H12BO9.2Na/c9-1-2-6(17-8(15)16-2)4(11)3(10)5(12)7(13)14;;/h2-6,9-11,15H,1H2,(H,13,14);;/q-1;2*+1/p-1 |
| Molecular Formula | C7H11BNa2O9 |
| Molecular Weight | 295.9474 |
| Boiling point | 632.4°C at 760 mmHg |
| Flash point | 336.3°C |
68134-31-6 l-glycero-l-ido-heptonic acid, cyclic 5,6-ester with boric acid, disodium salt
service@apichina.com