| Product Name | Itaconyl chloride |
| CAS No. | 1931-60-8 |
| Synonyms | 2,2-methylenesuccinyl dichloride; Methylenesuccinyl chloride; 2-methylidenebutanedioyl dichloride |
| InChI | InChI=1/C5H4Cl2O2/c1-3(5(7)9)2-4(6)8/h1-2H2 |
| Molecular Formula | C5H4Cl2O2 |
| Molecular Weight | 166.9901 |
| Density | 1.357g/cm3 |
| Boiling point | 197.9°C at 760 mmHg |
| Flash point | 90.2°C |
| Refractive index | 1.473 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1931-60-8 itaconyl chloride
service@apichina.com