| Product Name | Isovaleric anhydride |
| CAS No. | 1468-39-9 |
| Synonyms | Isopentanoic anhydride~3-Methylbutyric anhydride; 3-methylbutanoic anhydride |
| InChI | InChI=1/C10H18O3/c1-7(2)5-9(11)13-10(12)6-8(3)4/h7-8H,5-6H2,1-4H3 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.2481 |
| Density | 0.955g/cm3 |
| Boiling point | 215°C at 760 mmHg |
| Flash point | 91.3°C |
| Refractive index | 1.427 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1468-39-9 isovaleric anhydride
service@apichina.com