| Product Name | Isosorbide dimethyl ether |
| CAS No. | 5306-85-4 |
| Synonyms | 1,4:3,6-Dianhydrosorbitol 2,5-dimethyl ether; Dimethyl isoborbide; O,O-Dimethylisosorbide; 1,4:3,6-Dianhydro-2,5-O-dimethyl-D-glucitol; (3R,6S)-3,6-dimethoxyhexahydrofuro[3,2-b]furan; 1,4:3,6-Dianhydro-D-glucitol dimethyl ether; 1,4:3,6-Dianhydro-D-sorbitol dimethyl ether; Dimethyl Isosorbide; DMI; 1,4:3,6-dianhydro-2,5-di-O-methyl-D-glucitol; 1,4:3,6-dianhydro-2,5-di-O-methylhexitol |
| InChI | InChI=1/C8H14O4/c1-9-5-3-11-8-6(10-2)4-12-7(5)8/h5-8H,3-4H2,1-2H3 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.1944 |
| Density | 1.15g/cm3 |
| Boiling point | 236.4°C at 760 mmHg |
| Flash point | 108.3°C |
| Refractive index | 1.465 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
5306-85-4 isosorbide dimethyl ether
service@apichina.com