| Product Name | Isopropyl Phenylacetate |
| CAS No. | 4861-85-2 |
| Synonyms | 1-Methylethyl benzeneacetate; Acetic acid, phenyl-, isopropyl ester; Benzeneacetic acid, 1-methylethyl ester; FEMA No. 2956; Isopropyl alpha-toluate; propan-2-yl phenylacetate |
| InChI | InChI=1/C11H14O2/c1-9(2)13-11(12)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.2277 |
| Density | 1.014g/cm3 |
| Boiling point | 237.7°C at 760 mmHg |
| Flash point | 97.5°C |
| Refractive index | 1.497 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
4861-85-2 isopropyl phenylacetate
service@apichina.com