| Product Name | Isopropyl disulfide |
| CAS No. | 4253-89-8 |
| Synonyms | Diisopropyl sulphide; Diisopropyl disulfide; Isopropyl sulphide; 2-(propan-2-yldisulfanyl)propane; Di-isopropyl disulphide |
| InChI | InChI=1/C6H14S2/c1-5(2)7-8-6(3)4/h5-6H,1-4H3 |
| Molecular Formula | C6H14S2 |
| Molecular Weight | 150.3054 |
| Density | 0.961g/cm3 |
| Boiling point | 178.2°C at 760 mmHg |
| Flash point | 18.3°C |
| Refractive index | 1.497 |
| Hazard Symbols |  F:Highly flammable;  Xi:Irritant; |
| Risk Codes | R11:Highly flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
4253-89-8 isopropyl disulfide
service@apichina.com