| Product Name | Isopropyl 4-chloroacetoacetate |
| CAS No. | 41051-20-1 |
| Synonyms | 4-Chloroacetoacetic acid isopropyl ester; Isopropyl 4-chloro-3-oxobutanoate |
| InChI | InChI=1/C7H11ClO3/c1-5(2)11-7(10)3-6(9)4-8/h5H,3-4H2,1-2H3 |
| Molecular Formula | C7H11ClO3 |
| Molecular Weight | 178.61 |
| Density | 64 |
| Boiling point | 65℃ (25 torr) |
| Hazard Symbols | |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
41051-20-1 isopropyl 4-chloroacetoacetate
service@apichina.com