| Product Name | isopropyl 3,4,5-trihydroxybenzoate |
| CAS No. | 1138-60-9 |
| Synonyms | Isopropyl gallate; Gallic acid isopropyl ester; propan-2-yl 3,4,5-trihydroxybenzoate; Isopropylgallate |
| InChI | InChI=1/C10H12O5/c1-5(2)15-10(14)6-3-7(11)9(13)8(12)4-6/h3-5,11-13H,1-2H3 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.1993 |
| Density | 1.36g/cm3 |
| Boiling point | 439.5°C at 760 mmHg |
| Flash point | 177.4°C |
| Refractive index | 1.593 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1138-60-9 isopropyl 3,4,5-trihydroxybenzoate
service@apichina.com