| Product Name | isopropyl 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetate |
| CAS No. | 499771-13-0 |
| Synonyms | 1-methylethyl [2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetate |
| InChI | InChI=1/C14H14ClNO2S/c1-9(2)18-13(17)7-12-8-19-14(16-12)10-3-5-11(15)6-4-10/h3-6,8-9H,7H2,1-2H3 |
| Molecular Formula | C14H14ClNO2S |
| Molecular Weight | 295.7845 |
| Density | 1.255g/cm3 |
| Melting point | 82℃ |
| Boiling point | 406.7°C at 760 mmHg |
| Flash point | 199.7°C |
| Refractive index | 1.57 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
499771-13-0 isopropyl 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetate
service@apichina.com