| Product Name | Isopropanol-d8 |
| CAS No. | 22739-76-0 |
| Synonyms | 2-Propanol-d8; IPA-d8; Isopropyl alcohol-d8; propan-2-ol; (~2~H_7_)propan-2-(~2~H)ol |
| InChI | InChI=1/C3H8O/c1-3(2)4/h3-4H,1-2H3/i1D3,2D3,3D,4D |
| Molecular Formula | C3D8O |
| Molecular Weight | 68.1443 |
| Density | 0.897g/cm3 |
| Boiling point | 73°C at 760 mmHg |
| Flash point | 11.7°C |
| Refractive index | 1.376 |
| Hazard Symbols |  F:Highly flammable;  Xi:Irritant; |
| Risk Codes | R11:Highly flammable.; R36:Irritating to eyes.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S24/25:Avoid contact with skin and eyes.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S7:Keep container tightly closed.; |
22739-76-0 isopropanol-d8
service@apichina.com