| Product Name | Isopilocarpine nitrate |
| CAS No. | 5984-94-1 |
| Synonyms | beta-pilocarpine nitrate; (3R,4R)-3-ethyl-4-[(1-methyl-1H-imidazol-5-yl)methyl]dihydrofuran-2(3H)-one nitrate (1:1); dihydroxy-oxo-ammonium; 3-ethyl-4-[(3-methylimidazol-4-yl)methyl]tetrahydrofuran-2-one |
| InChI | InChI=1/C11H16N2O2.H2NO3/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2;2-1(3)4/h5,7-8,10H,3-4,6H2,1-2H3;(H2,2,3,4)/q;+1 |
| Molecular Formula | C11H18N3O5 |
| Molecular Weight | 272.2772 |
| Melting point | 157℃ |
| Boiling point | 431.8°C at 760 mmHg |
| Flash point | 215°C |
| Hazard Symbols |  T+:Very toxic; |
| Risk Codes | R26/28:Very toxic by inhalation and if swallowed.; |
| Safety | S25:Avoid contact with eyes.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
5984-94-1 isopilocarpine nitrate
service@apichina.com