| Product Name | isopentyl benzoate |
| CAS No. | 94-46-2 |
| Synonyms | Benzoic acid isoamyl ester; 3-methyl-1-butanol benzoate; benzoic acid isopentyl ester; Isoamyl Benzoate; 3-methylbutyl benzoate |
| InChI | InChI=1/C12H16O2/c1-10(2)8-9-14-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.2542 |
| Density | 0.992g/cm3 |
| Boiling point | 260°C at 760 mmHg |
| Flash point | 109.4°C |
| Refractive index | 1.495 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
94-46-2 isopentyl benzoate
service@apichina.com