| Product Name | isooctyl dihydrogen phosphate, compound with 2-ethylhexylamine (1:2) |
| CAS No. | 61188-13-4 |
| Synonyms | Phosphoric acid, monoisooctyl ester, compd. with 2-ethyl-1-hexanamine (1:2); Isooctyl phosphate (1:1), 2-ethylhexylamine salt (1:2); Monoisooctyl phosphate 2-ethylhexylamine salt (1:2); Isooctyl dihydrogen phosphate, compound with 2-ethylhexylamine (1:2); 6-methylheptyl dihydrogen phosphate - 2-ethylhexan-1-amine (1:1) |
| InChI | InChI=1/C8H19N.C8H19O4P/c1-3-5-6-8(4-2)7-9;1-8(2)6-4-3-5-7-12-13(9,10)11/h8H,3-7,9H2,1-2H3;8H,3-7H2,1-2H3,(H2,9,10,11) |
| Molecular Formula | C16H38NO4P |
| Molecular Weight | 339.451 |
| Boiling point | 321.8°C at 760 mmHg |
| Flash point | 148.4°C |
61188-13-4 isooctyl dihydrogen phosphate, compound with 2-ethylhexylamine (1:2)
service@apichina.com