| Product Name | Isooctadecanoic acid, ester with oxybis[propanediol] |
| CAS No. | 73296-86-3 |
| Synonyms | Diglyceryl isostearate; Isooctanoic acid, monoester with diglycerol; Polyglyceryl-2 isostearate; Diglycerol isostearate; Isooctadecanoic acid, ester with oxybis(propanediol); 16-methylheptadecanoic acid - 3,3'-oxydipropane-1,2-diol (1:1) |
| InChI | InChI=1/C18H36O2.C6H14O5/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;7-1-5(9)3-11-4-6(10)2-8/h17H,3-16H2,1-2H3,(H,19,20);5-10H,1-4H2 |
| Molecular Formula | C24H50O7 |
| Molecular Weight | 450.6496 |
| Boiling point | 400.8°C at 760 mmHg |
| Flash point | 225.7°C |
73296-86-3 isooctadecanoic acid, ester with oxybis[propanediol]
service@apichina.com