| Product Name | isooctadecanoic acid, compound with N,N-dimethyldodecylamine (1:1) |
| CAS No. | 70729-87-2 |
| Synonyms | Dimethyl lauramine isostearate; Dimethyl laurylamine isostearate; Dimethyllaurylamine isostearate; Isooctadecanoic acid, compd. with N,N-dimethyl-1-dodecanamine (1:1); Isooctadecanoic acid, compound with N,N-dimethyldodecylamine (1:1); 16-methylheptadecanoic acid - N,N-dimethyldodecan-1-amine (1:1) |
| InChI | InChI=1/C18H36O2.C14H31N/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;1-4-5-6-7-8-9-10-11-12-13-14-15(2)3/h17H,3-16H2,1-2H3,(H,19,20);4-14H2,1-3H3 |
| Molecular Formula | C32H67NO2 |
| Molecular Weight | 497.8799 |
| Boiling point | 400.8°C at 760 mmHg |
| Flash point | 225.6°C |
70729-87-2 isooctadecanoic acid, compound with n,n-dimethyldodecylamine (1:1)
service@apichina.com