| Product Name | Isobutylthioethanol |
| CAS No. | 42779-10-2 |
| Synonyms | 2-(Isobutylsulfanyl)ethanol; 2-Hydroxyethyl isobutyl sulfide; ethanol, 2-[(2-methylpropyl)thio]-; 2-[(2-methylpropyl)sulfanyl]ethanol |
| InChI | InChI=1/C6H14OS/c1-6(2)5-8-4-3-7/h6-7H,3-5H2,1-2H3 |
| Molecular Formula | C6H14OS |
| Molecular Weight | 134.2398 |
| Density | 0.962g/cm3 |
| Boiling point | 211°C at 760 mmHg |
| Flash point | 103.4°C |
| Refractive index | 1.476 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; |
42779-10-2 isobutylthioethanol
service@apichina.com