| Product Name | Isobutyl isothiocyanate |
| CAS No. | 591-82-2 |
| Synonyms | Isothiocyanic acid, isobutyl ester; 1-Isothiocyanato-2-methylpropane; 2-Methylpropyl isothiocyanate; 4-04-00-00653 (Beilstein Handbook Reference); BRN 1740371; EINECS 209-733-2; i-Butyl isothiocyanate; Propane, 1-isothiocyanato-2-methyl- |
| InChI | InChI=1/C5H9NS/c1-5(2)3-6-4-7/h5H,3H2,1-2H3 |
| Molecular Formula | C5H9NS |
| Molecular Weight | 115.1967 |
| Density | 0.92g/cm3 |
| Boiling point | 163.3°C at 760 mmHg |
| Flash point | 44.2°C |
| Refractive index | 1.485 |
| Hazard Symbols | |
| Risk Codes | R10:Flammable.; R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
591-82-2 isobutyl isothiocyanate
service@apichina.com