| Product Name | isobutyl formate |
| CAS No. | 542-55-2 |
| Synonyms | Isobutyl methanoate; Tertyl formate; Formic acid isobutyl ester; 2-methylpropyl formate |
| InChI | InChI=1/C5H10O2/c1-5(2)3-7-4-6/h4-5H,3H2,1-2H3 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.1317 |
| Density | 0.887g/cm3 |
| Melting point | -96℃ |
| Boiling point | 99.5°C at 760 mmHg |
| Flash point | 10°C |
| Refractive index | 1.386 |
| Hazard Symbols |  F:Highly flammable;  Xi:Irritant; |
| Risk Codes | R11:Highly flammable.; R36/37:Irritating to eyes and respiratory system.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S24:Avoid contact with skin.; S33:Take precautionary measures against static discharges.; S9:Keep container in a well-ventilated place.; |
542-55-2 isobutyl formate
service@apichina.com