| Product Name | Isoamylamine |
| CAS No. | 107-85-7 |
| Synonyms | 3-Methyl-1-butanamine; Isopentylamine; 3-Methylbutylamine; 1-amino-3-methylbutane; 3-methylbutan-1-amine; 3-methylbutan-1-amine hydrochloride (1:1); 3-methylbutan-1-aminium |
| InChI | InChI=1/C5H13N/c1-5(2)3-4-6/h5H,3-4,6H2,1-2H3/p+1 |
| Molecular Formula | C5H14N |
| Molecular Weight | 88.1708 |
| Melting point | -60℃ |
| Boiling point | 92.7°C at 760 mmHg |
| Flash point | 18.3°C |
| Hazard Symbols |  F:Highly flammable;  C:Corrosive; |
| Risk Codes | R11:Highly flammable.; R34:Causes burns.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S24/25:Avoid contact with skin and eyes.; |
107-85-7 isoamylamine
service@apichina.com