| Product Name | Isoamyl 3-(methylthio)propionate |
| CAS No. | 93762-35-7 |
| Synonyms | Isopentyl 3-(methylthio)propionate~3-Methylbutyl 3-(methylthio)propionate; pentyl 3-(methylsulfanyl)propanoate; 3-methylbutyl 3-(methylsulfanyl)propanoate |
| InChI | InChI=1/C9H18O2S/c1-8(2)4-6-11-9(10)5-7-12-3/h8H,4-7H2,1-3H3 |
| Molecular Formula | C9H18O2S |
| Molecular Weight | 190.303 |
| Density | 0.976g/cm3 |
| Boiling point | 252.7°C at 760 mmHg |
| Flash point | 103.9°C |
| Refractive index | 1.46 |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
93762-35-7 isoamyl 3-(methylthio)propionate
service@apichina.com