| Product Name | iodotrifluoroethylene |
| CAS No. | 359-37-5 |
| Synonyms | Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
| InChI | InChI=1/C2F3I/c3-1(4)2(5)6 |
| Molecular Formula | C2F3I |
| Molecular Weight | 207.9211 |
| Density | 2.311g/cm3 |
| Boiling point | 30°C at 760 mmHg |
| Refractive index | 1.457 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
359-37-5 iodotrifluoroethylene
service@apichina.com