| Product Name | iodopentafluorobenzene |
| CAS No. | 827-15-6 |
| Synonyms | Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene |
| InChI | InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| Molecular Formula | C6F5I |
| Molecular Weight | 293.9607 |
| Density | 2.217g/cm3 |
| Boiling point | 166.7°C at 760 mmHg |
| Flash point | 61.3°C |
| Refractive index | 1.502 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
827-15-6 iodopentafluorobenzene
service@apichina.com