| Product Name | Iodoacetyl chloride |
| CAS No. | 38020-81-4 |
| InChI | InChI=1/C2H2ClIO/c3-2(5)1-4/h1H2 |
| Molecular Formula | C2H2ClIO |
| Molecular Weight | 204.3941 |
| Density | 2.299g/cm3 |
| Boiling point | 165.2°C at 760 mmHg |
| Flash point | 53.7°C |
| Refractive index | 1.57 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
38020-81-4 iodoacetyl chloride
service@apichina.com