| Sales Email | Service@apichina.com |
| CAS No. | 305-53-3 |
| Product Name | Iodoacetic acid, sodium salt |
| Synonyms | Sodium iodoacetate; Iodoacetic acid sodium salt |
| InChI | InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| Molecular Formula | C2H2INaO2 |
| Molecular Weight | 207.9303 |
| Melting point | 208-210℃ |
| Boiling point | 262.1°C at 760 mmHg |
| Flash point | 112.3°C |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R25:Toxic if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
