| Sales Email | Service@apichina.com |
| CAS No. | 608-08-2 |
| Product Name | Indoxyl acetate |
| Synonyms | 3-Acetoxyindole~Indolyl acetate~Y-acetate; Indoxyl acetate 3-Indoxyl acetate; 3-Indolyl acetate; 3-Acetoxyindole; 1H-indol-3-yl acetate |
| InChI | InChI=1/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.184 |
| Density | 1.255g/cm3 |
| Melting point | 128-131℃ |
| Boiling point | 339.1°C at 760 mmHg |
| Flash point | 158.9°C |
| Refractive index | 1.633 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
