| Product Name | Indole-3-glyoxylyl chloride |
| CAS No. | 22980-09-2 |
| Synonyms | alpha-Oxoindoleacetyl chloride; ALPHA-Oxo-1H-indole-3-acetyl chloride; 1H-indol-3-yl(oxo)acetyl chloride |
| InChI | InChI=1/C10H6ClNO2/c11-10(14)9(13)7-5-12-8-4-2-1-3-6(7)8/h1-5,12H |
| Molecular Formula | C10H6ClNO2 |
| Molecular Weight | 207.6131 |
| Density | 1.463g/cm3 |
| Melting point | 138℃ |
| Boiling point | 413.9°C at 760 mmHg |
| Flash point | 204.1°C |
| Refractive index | 1.676 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
22980-09-2 indole-3-glyoxylyl chloride
service@apichina.com