| Product Name | hydroxypropyl acrylate, mixture of isomers |
| CAS No. | 25584-83-2 |
| Synonyms | Hydroxypropyl acrylate,mixture of isomers; Acrylic acid hydroxypropyl ester; BISOMER HPA; 2-hydroxypropyl prop-2-enoate; 1-hydroxypropan-2-yl prop-2-enoate; 1-hydroxypropyl prop-2-enoate; Hydroxypropyl acrylate |
| InChI | InChI=1/C6H10O3/c1-3-5(7)9-6(8)4-2/h3,6,8H,1,4H2,2H3 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.1418 |
| Density | 1.049g/cm3 |
| Boiling point | 175.4°C at 760 mmHg |
| Flash point | 64.3°C |
| Refractive index | 1.442 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:; R34:; R43:; |
| Safety | S26:; S36/37/39:; S45:; |
25584-83-2 hydroxypropyl acrylate, mixture of isomers
service@apichina.com