| Product Name | Hydroxyethylcyanonitroaniline |
| CAS No. | 63989-40-2 |
| Synonyms | 2-(2-HYDROXYETHYLAMINO)-5-NITROBENZONITRILE; 2-[(2-Hydroxyethyl)amino]-5-nitrobenzonitrile; benzonitrile, 2-[(2-hydroxyethyl)amino]-5-nitro- |
| InChI | InChI=1/C9H9N3O3/c10-6-7-5-8(12(14)15)1-2-9(7)11-3-4-13/h1-2,5,11,13H,3-4H2 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.1861 |
| Density | 1.38g/cm3 |
| Boiling point | 442.6°C at 760 mmHg |
| Flash point | 221.5°C |
| Refractive index | 1.607 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
63989-40-2 hydroxyethylcyanonitroaniline
service@apichina.com