| Product Name | hydroxyethyl methacrylate-methacrylic acid-ethyl methacrylate copolymer |
| CAS No. | 101842-61-9 |
| Synonyms | Hydroxyethyl methacrylate-methacrylic acid-ethyl methacrylate copolymer; HFMC; 2-Propenoic acid, 2-methyl-, polymer with ethyl 2-methyl-2-propenoate and 2-hydroxyethyl 2-methyl-2-propenoate; ethyl 2-methylprop-2-enoate; 2-hydroxyethyl 2-methylprop-2-enoate; 2-methylprop-2-enoic acid |
| InChI | InChI=1/C6H10O3.C6H10O2.C4H6O2/c1-5(2)6(8)9-4-3-7;1-4-8-6(7)5(2)3;1-3(2)4(5)6/h7H,1,3-4H2,2H3;2,4H2,1,3H3;1H2,2H3,(H,5,6) |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.3734 |
| Boiling point | 189°C at 760 mmHg |
| Flash point | 97.2°C |
101842-61-9 hydroxyethyl methacrylate-methacrylic acid-ethyl methacrylate copolymer
service@apichina.com