| Product Name | hydrogen fluoride 2,4,6-trimethyl-pyridine |
| CAS No. | 45725-47-1 |
| Synonyms | Hydrogen fluoride 2,4,6-trimethylpyridine; Hydrogen fluoride 2,4,6-collidine complex; 2,4,6-Collidine hydrogen fluoride; 2,4,6-Trimethylpyridine hydrogen fluoride; Hydrogen fluoridecollidine; 2,4,6-trimethylpyridine hydrofluoride |
| InChI | InChI=1/C8H11N.FH/c1-6-4-7(2)9-8(3)5-6;/h4-5H,1-3H3;1H |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.186 |
| Boiling point | 235.6°C at 760 mmHg |
| Flash point | 96.3°C |
| Risk Codes | R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.; R35:Causes severe burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
45725-47-1 hydrogen fluoride 2,4,6-trimethyl-pyridine
service@apichina.com