| Product Name | Homophthalic anhydride |
| CAS No. | 703-59-3 |
| Synonyms | 1,3-Isochromandione; benzoglutaric anhydride; 1H-isochromene-1,3(4H)-dione; o-Carboxyphenylacetic acid cyclic anhydride~1,3-Isochromanedione |
| InChI | InChI=1/C9H6O3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-4H,5H2 |
| Molecular Formula | C9H6O3 |
| Molecular Weight | 162.1421 |
| Density | 1.347g/cm3 |
| Melting point | 140-144℃ |
| Boiling point | 324.5°C at 760 mmHg |
| Flash point | 159°C |
| Refractive index | 1.584 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
703-59-3 homophthalic anhydride
service@apichina.com