| Product Name | Hexanophenone |
| CAS No. | 942-92-7 |
| Synonyms | n-Amyl phenyl ketone; Phenyl n-pentyl ketone; Amyl phenyl ketone; 1-phenylhexan-1-one |
| InChI | InChI=1/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.2548 |
| Density | 0.942g/cm3 |
| Melting point | 25-26℃ |
| Boiling point | 265°C at 760 mmHg |
| Flash point | 105.5°C |
| Refractive index | 1.498 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
942-92-7 hexanophenone
service@apichina.com