| Product Name | Hexanoic anhydride |
| CAS No. | 2051-49-2 |
| Synonyms | Caproic anhydride; Hexanoic Acid Anhydride; N-hexanoic anhydride |
| InChI | InChI=1/C12H22O3/c1-3-5-7-9-11(13)15-12(14)10-8-6-4-2/h3-10H2,1-2H3 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.3013 |
| Density | 0.943g/cm3 |
| Melting point | -40℃ |
| Boiling point | 247°C at 760 mmHg |
| Flash point | 116.6°C |
| Refractive index | 1.436 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
2051-49-2 hexanoic anhydride
service@apichina.com