| Product Name | hexadecylmalonic acid |
| CAS No. | 4371-64-6 |
| Synonyms | 224-466-1; Hexadecylmalonic acid; Propanedioic acid, 2-hexadecyl-; Propanedioic acid, hexadecyl-; hexadecylpropanedioic acid |
| InChI | InChI=1/C19H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18(20)21)19(22)23/h17H,2-16H2,1H3,(H,20,21)(H,22,23) |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.4867 |
| Density | 0.99g/cm3 |
| Boiling point | 476.8°C at 760 mmHg |
| Flash point | 256.3°C |
| Refractive index | 1.473 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
4371-64-6 hexadecylmalonic acid
service@apichina.com