| Product Name | Hexabromobenzene |
| CAS No. | 87-82-1 |
| Synonyms | AI3-60220; CCRIS 5917; HSDB 2912; NSC 113975; Benzene, 1,2,3,4,5,6-hexabromo-; Benzene, hexabromo- |
| InChI | InChI=1/C6Br6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| Molecular Formula | C6Br6 |
| Molecular Weight | 551.49 |
| Melting point | 326-327℃ |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
87-82-1 hexabromobenzene
service@apichina.com