| Product Name | Hexaaminecobalt(III) chloride |
| CAS No. | 10534-89-1 |
| Synonyms | Hexaamine cobalt(III) chloride; hexamminecobalttrichloride; Hexaamminecobalt (III) chloride; Hexamminecobalt(III) chloride; hexaamminecobalt trichloride; Hexaamminecobaltchlorideorangepowder; cobalt(3+) chloride ammoniate (1:3:6); azanide; cobalt |
| InChI | InChI=1/C6H12N4.ClH.Co/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h1-6H2;1H;/q;;+2/p-1 |
| Molecular Formula | C6H12ClCoN4 |
| Molecular Weight | 234.5719 |
| Melting point | 217℃ |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
10534-89-1 hexaaminecobalt(iii) chloride
service@apichina.com