| Product Name | Hesperetin |
| CAS No. | 520-33-2;41001-90-5 |
| Synonyms | 3,5,7-Trihydroxy-4-methoxyflavanone; 4-Methoxy-3,5,7-trihydroxyflavanone; Hesperin; 3',5,7-Trihydroxy-4'-methoxyflavanone; 4'-Methoxy-3',5,7-trihydroxyflavanone; Hesperetine; Hesperitin ; 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one; (2S)-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| InChI | InChI=1/C16H14O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.2788 |
| Density | 1.458g/cm3 |
| Boiling point | 586.2°C at 760 mmHg |
| Flash point | 223°C |
| Refractive index | 1.664 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
520-33-2;41001-90-5 hesperetin
service@apichina.com