| Product Name | heptanal, cyclic acetal with glycerol |
| CAS No. | 72854-42-3 |
| Synonyms | Heptanal, cyclic acetal with 1,2,3-propanetriol; Heptanal, cyclic acetal with glycerol; 1-(heptyloxy)-3-hydroxypropan-2-one |
| InChI | InChI=1/C10H20O3/c1-2-3-4-5-6-7-13-9-10(12)8-11/h11H,2-9H2,1H3 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.264 |
| Density | 0.967g/cm3 |
| Boiling point | 297.4°C at 760 mmHg |
| Flash point | 108.7°C |
| Refractive index | 1.443 |
72854-42-3 heptanal, cyclic acetal with glycerol
service@apichina.com