| Product Name | Harmine hydrochloride hydrate |
| CAS No. | 343-27-1 |
| Synonyms | 7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole hydrochloride hydrate; Harmine hydrochlorid; Banisterine, Telepathine; 7-methoxy-1-methyl-9H-beta-carbolin-9-ium chloride; Harmine Hydrochloride |
| InChI | InChI=1/C13H12N2O.ClH/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;/h3-7,15H,1-2H3;1H |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.7081 |
| Melting point | 265-270℃ |
| Boiling point | 421.4°C at 760 mmHg |
| Flash point | 139.8°C |
| Hazard Symbols | |
| Risk Codes | R40:Possible risks of irreversible effects.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
343-27-1 harmine hydrochloride hydrate
service@apichina.com