| Product Name | Harmane |
| CAS No. | 486-84-0 |
| Synonyms | 1-Methyl-9H-pyrido[3,4-b]indole; Aribine~1-Methyl-9H-pyrido[3,4-b]indole; harman; 1-methyl-9H-beta-carboline; 2-Methyl-?carboline; Aribine; 1-methyl-9H-beta-carboline |
| InChI | InChI=1/C12H10N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-7,14H,1H3 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.2212 |
| Density | 1.252g/cm3 |
| Melting point | 235-239℃ |
| Boiling point | 386.9°C at 760 mmHg |
| Flash point | 176.2°C |
| Refractive index | 1.75 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S22:Do not inhale dust.; |
486-84-0 harmane
service@apichina.com