| Product Name | H-D-Phg-OEt . HCl |
| CAS No. | 17609-48-2 |
| Synonyms | D-(-)-alpha-Phenylglycine ethyl ester hydrochloride; (R)-(-)-alpha-Aminophenylacetic acid ethyl ester hydrochloride~H-D-Phg-OEt.HCl; ethyl (2-aminophenyl)acetate hydrochloride; ethyl (2R)-amino(phenyl)ethanoate |
| InChI | InChI=1/C10H13NO2/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9H,2,11H2,1H3/t9-/m1/s1 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.2157 |
| Density | 1.098g/cm3 |
| Boiling point | 257°C at 760 mmHg |
| Flash point | 120°C |
| Refractive index | 1.529 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
17609-48-2 h-d-phg-oet . hcl
service@apichina.com