| Product Name | Gramine |
| CAS No. | 87-52-5 |
| Synonyms | 3-(Dimethylaminomethyl)indole; (1H-Indol-3-ylmethyl)-dimethyl-amine |
| InChI | InChI=1/C11H14N2/c1-13(2)8-9-7-12-11-6-4-3-5-10(9)11/h3-7,12H,8H2,1-2H3 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.2423 |
| Density | 1.099g/cm3 |
| Melting point | 131-139℃ |
| Boiling point | 293.9°C at 760 mmHg |
| Flash point | 131.5°C |
| Water solubility | PRACTICALLY INSOLUBLE |
| Refractive index | 1.63 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S46:If swallowed, seek medical advice immediately and show this container or label.; |
87-52-5 gramine
service@apichina.com