| Product Name | Glyoxal dithiosemicarbazone |
| CAS No. | 1072-12-4 |
| Synonyms | Glyoxal bis(thiosemicarbazone); ethanedial dithiosemicarbazone; (1Z,2Z)-ethanedial dithiosemicarbazone |
| InChI | InChI=1/C4H8N6S2/c5-3(11)9-7-1-2-8-10-4(6)12/h1-2H,(H3,5,9,11)(H3,6,10,12)/b7-1-,8-2- |
| Molecular Formula | C4H8N6S2 |
| Molecular Weight | 204.2765 |
| Density | 1.61g/cm3 |
| Boiling point | 384.6°C at 760 mmHg |
| Flash point | 186.4°C |
| Refractive index | 1.75 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
1072-12-4 glyoxal dithiosemicarbazone
service@apichina.com