| Product Name | Glycolaldehyde dimethyl acetal |
| CAS No. | 30934-97-5 |
| Synonyms | 2,2-Dimethoxyethanol~Hydroxyacetaldehyde dimethyl acetal; 2,2-Dimethoxyethanol; 2,3-dimethoxy ethanol |
| InChI | InChI=1/C4H10O3/c1-6-4(3-5)7-2/h4-5H,3H2,1-2H3 |
| Molecular Formula | C4H10O3 |
| Molecular Weight | 106.1204 |
| Density | 1.009g/cm3 |
| Boiling point | 146.1°C at 760 mmHg |
| Flash point | 42.2°C |
| Refractive index | 1.401 |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
30934-97-5 glycolaldehyde dimethyl acetal
service@apichina.com