| Product Name | Glycine octyl ester hydrochloride |
| CAS No. | 39540-30-2 |
| Synonyms | Glycine n-octyl ester hydrochloride; octyl glycinate hydrochloride |
| InChI | InChI=1/C10H21NO2.ClH/c1-2-3-4-5-6-7-8-13-10(12)9-11;/h2-9,11H2,1H3;1H |
| Molecular Formula | C10H22ClNO2 |
| Molecular Weight | 223.7402 |
| Boiling point | 243.5°C at 760 mmHg |
| Flash point | 108.5°C |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
39540-30-2 glycine octyl ester hydrochloride
service@apichina.com